C15H18N2O3 — CID 15446010
1-(hydrazinecarbonyl)-4-methyl-6-phenylcyclohex-3-ene-1-carboxylic acid (PubChem CID 15446010) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-(hydrazinecarbonyl)-4-methyl-6-phenylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | 1-(hydrazinecarbonyl)-4-methyl-6-phenylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 15446010 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 1-(hydrazinecarbonyl)-4-methyl-6-phenylcyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1=CCC(C(=O)O)(C(=O)NN)C(c2ccccc2)C1 |
| InChI | InChI=1S/C15H18N2O3/c1-10-7-8-15(14(19)20,13(18)17-16)12(9-10)11-5-3-2-4-6-11/h2-7,12H,8-9,16H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | ZUYNXCWMUPBDRY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|