C22H21N2O5- — CID 6979035
(1S,6S)-1-(benzylcarbamoyl)-4-methyl-6-(4-nitrophenyl)cyclohex-3-ene-1-carboxylate (PubChem CID 6979035) has the molecular formula C22H21N2O5- and a molecular weight of 393.42 g/mol. Its IUPAC name is (1S,6S)-1-(benzylcarbamoyl)-4-methyl-6-(4-nitrophenyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6S)-1-(benzylcarbamoyl)-4-methyl-6-(4-nitrophenyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 6979035 |
| Molecular Formula | C22H21N2O5- |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | (1S,6S)-1-(benzylcarbamoyl)-4-methyl-6-(4-nitrophenyl)cyclohex-3-ene-1-carboxylate |
| SMILES | CC1=CC[C@@](C(=O)[O-])(C(=O)NCc2ccccc2)[C@H](c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C22H22N2O5/c1-15-11-12-22(21(26)27,20(25)23-14-16-5-3-2-4-6-16)19(13-15)17-7-9-18(10-8-17)24(28)29/h2-11,19H,12-14H2,1H3,(H,23,25)(H,26,27)/p-1/t19-,22-/m0/s1 |
| InChIKey | NQNGMUYYUBWMLT-UGKGYDQZSA-M |
| XLogP | 2.47 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|