C30H26N2O3 — CID 12036244
1-(3,5-diphenylpyrazole-1-carbonyl)-4-methyl-6-phenylcyclohex-3-ene-1-carboxylic acid (PubChem CID 12036244) has the molecular formula C30H26N2O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is 1-(3,5-diphenylpyrazole-1-carbonyl)-4-methyl-6-phenylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | 1-(3,5-diphenylpyrazole-1-carbonyl)-4-methyl-6-phenylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 12036244 |
| Molecular Formula | C30H26N2O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 1-(3,5-diphenylpyrazole-1-carbonyl)-4-methyl-6-phenylcyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1=CCC(C(=O)O)(C(=O)n2nc(-c3ccccc3)cc2-c2ccccc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C30H26N2O3/c1-21-17-18-30(29(34)35,25(19-21)22-11-5-2-6-12-22)28(33)32-27(24-15-9-4-10-16-24)20-26(31-32)23-13-7-3-8-14-23/h2-17,20,25H,18-19H2,1H3,(H,34,35) |
| InChIKey | DPBIBTOJKBMGGO-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|