About cyclohept-4-ene-1,2-dithiol
cyclohept-4-ene-1,2-dithiol (PubChem CID 175095549) has the molecular formula C7H12S2
and a molecular weight of 160.31 g/mol. Its IUPAC name is cyclohept-4-ene-1,2-dithiol.
Molecular Properties
| Compound Name | cyclohept-4-ene-1,2-dithiol |
| PubChem CID | 175095549 |
| Molecular Formula | C7H12S2 |
| Molecular Weight | 160.31 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | cyclohept-4-ene-1,2-dithiol |
| SMILES | SC1CC=CCCC1S |
| InChI | InChI=1S/C7H12S2/c8-6-4-2-1-3-5-7(6)9/h1-2,6-9H,3-5H2 |
| InChIKey | SMFFSXOZORZBQY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze cyclohept-4-ene-1,2-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohept-4-ene-1,2-dithiol?
The IUPAC name of cyclohept-4-ene-1,2-dithiol (CID 175095549) is cyclohept-4-ene-1,2-dithiol.
What is the SMILES notation for cyclohept-4-ene-1,2-dithiol?
The canonical SMILES for cyclohept-4-ene-1,2-dithiol is SC1CC=CCCC1S.
What is the InChIKey of cyclohept-4-ene-1,2-dithiol?
The InChIKey is SMFFSXOZORZBQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12S2/c8-6-4-2-1-3-5-7(6)9/h1-2,6-9H,3-5H2.
What are the key properties of cyclohept-4-ene-1,2-dithiol?
cyclohept-4-ene-1,2-dithiol has a molecular weight of 160.31 g/mol, XLogP of 2.32, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohept-4-ene-1,2-dithiol is sourced from PubChem (CID 175095549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).