C19H22F2N2O2S — CID 175099089
4-[3-(difluoromethoxy)phenyl]sulfanyl-N-ethyl-N',2,5-trimethylbenzohydrazide (PubChem CID 175099089) has the molecular formula C19H22F2N2O2S and a molecular weight of 380.46 g/mol. Its IUPAC name is 4-[3-(difluoromethoxy)phenyl]sulfanyl-N-ethyl-N',2,5-trimethylbenzohydrazide.
| Compound Name | 4-[3-(difluoromethoxy)phenyl]sulfanyl-N-ethyl-N',2,5-trimethylbenzohydrazide |
|---|---|
| PubChem CID | 175099089 |
| Molecular Formula | C19H22F2N2O2S |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 4-[3-(difluoromethoxy)phenyl]sulfanyl-N-ethyl-N',2,5-trimethylbenzohydrazide |
| SMILES | CCN(NC)C(=O)c1cc(C)c(Sc2cccc(OC(F)F)c2)cc1C |
| InChI | InChI=1S/C19H22F2N2O2S/c1-5-23(22-4)18(24)16-9-13(3)17(10-12(16)2)26-15-8-6-7-14(11-15)25-19(20)21/h6-11,19,22H,5H2,1-4H3 |
| InChIKey | GIQHQCIMKAHFAD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|