C19H23F2N3OS — CID 175046320
2-[4-[3-(difluoromethoxy)phenyl]sulfanyl-2,5-dimethylphenyl]-1-ethyl-1-methylguanidine (PubChem CID 175046320) has the molecular formula C19H23F2N3OS and a molecular weight of 379.48 g/mol. Its IUPAC name is 2-[4-[3-(difluoromethoxy)phenyl]sulfanyl-2,5-dimethylphenyl]-1-ethyl-1-methylguanidine.
| Compound Name | 2-[4-[3-(difluoromethoxy)phenyl]sulfanyl-2,5-dimethylphenyl]-1-ethyl-1-methylguanidine |
|---|---|
| PubChem CID | 175046320 |
| Molecular Formula | C19H23F2N3OS |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-[4-[3-(difluoromethoxy)phenyl]sulfanyl-2,5-dimethylphenyl]-1-ethyl-1-methylguanidine |
| SMILES | CCN(C)/C(N)=N/c1cc(C)c(Sc2cccc(OC(F)F)c2)cc1C |
| InChI | InChI=1S/C19H23F2N3OS/c1-5-24(4)19(22)23-16-9-13(3)17(10-12(16)2)26-15-8-6-7-14(11-15)25-18(20)21/h6-11,18H,5H2,1-4H3,(H2,22,23) |
| InChIKey | OIHWSQAHINLFJG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|