C21H27N5O5S2 — CID 175101274
[[3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]cyclobutyl]-propylsulfonylamino] 4-methylbenzenesulfonate (PubChem CID 175101274) has the molecular formula C21H27N5O5S2 and a molecular weight of 493.61 g/mol. Its IUPAC name is [[3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]cyclobutyl]-propylsulfonylamino] 4-methylbenzenesulfonate.
| Compound Name | [[3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]cyclobutyl]-propylsulfonylamino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 175101274 |
| Molecular Formula | C21H27N5O5S2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | [[3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]cyclobutyl]-propylsulfonylamino] 4-methylbenzenesulfonate |
| SMILES | CCCS(=O)(=O)N(OS(=O)(=O)c1ccc(C)cc1)C1CC(N(C)c2ncnc3[nH]ccc23)C1 |
| InChI | InChI=1S/C21H27N5O5S2/c1-4-11-32(27,28)26(31-33(29,30)18-7-5-15(2)6-8-18)17-12-16(13-17)25(3)21-19-9-10-22-20(19)23-14-24-21/h5-10,14,16-17H,4,11-13H2,1-3H3,(H,22,23,24) |
| InChIKey | ZBSMHOQFVBZIKF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 125.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|