C13H23NO5 — CID 175102179
(2S)-3,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-oxoethyl)butanoic acid (PubChem CID 175102179) has the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-oxoethyl)butanoic acid.
| Compound Name | (2S)-3,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-oxoethyl)butanoic acid |
|---|---|
| PubChem CID | 175102179 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | (2S)-3,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-oxoethyl)butanoic acid |
| SMILES | CC(C)(C)OC(=O)NCC(C)(C)C(CC=O)C(=O)O |
| InChI | InChI=1S/C13H23NO5/c1-12(2,3)19-11(18)14-8-13(4,5)9(6-7-15)10(16)17/h7,9H,6,8H2,1-5H3,(H,14,18)(H,16,17) |
| InChIKey | MLOGPJFVMBDKHP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|