C13H14ClN3O2 — CID 175104405
methyl 2-[(8-chloro-2-methyl-1,7-naphthyridin-3-yl)methylamino]acetate (PubChem CID 175104405) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is methyl 2-[(8-chloro-2-methyl-1,7-naphthyridin-3-yl)methylamino]acetate.
| Compound Name | methyl 2-[(8-chloro-2-methyl-1,7-naphthyridin-3-yl)methylamino]acetate |
|---|---|
| PubChem CID | 175104405 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | methyl 2-[(8-chloro-2-methyl-1,7-naphthyridin-3-yl)methylamino]acetate |
| SMILES | COC(=O)CNCc1cc2ccnc(Cl)c2nc1C |
| InChI | InChI=1S/C13H14ClN3O2/c1-8-10(6-15-7-11(18)19-2)5-9-3-4-16-13(14)12(9)17-8/h3-5,15H,6-7H2,1-2H3 |
| InChIKey | ZOBVMYUNBWUQAF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|