C11H26OSi2 — CID 175106629
2,2,6-triethyl-3,3-dimethyloxadisilinane (PubChem CID 175106629) has the molecular formula C11H26OSi2 and a molecular weight of 230.50 g/mol. Its IUPAC name is 2,2,6-triethyl-3,3-dimethyloxadisilinane.
| Compound Name | 2,2,6-triethyl-3,3-dimethyloxadisilinane |
|---|---|
| PubChem CID | 175106629 |
| Molecular Formula | C11H26OSi2 |
| Molecular Weight | 230.50 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2,2,6-triethyl-3,3-dimethyloxadisilinane |
| SMILES | CCC1CC[Si](C)(C)[Si](CC)(CC)O1 |
| InChI | InChI=1S/C11H26OSi2/c1-6-11-9-10-13(4,5)14(7-2,8-3)12-11/h11H,6-10H2,1-5H3 |
| InChIKey | SAZBLIQOHIMLAK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|