C8H20OSSi2 — CID 175382099
(2,2,3,3-tetramethyloxadisilinan-6-yl)methanethiol (PubChem CID 175382099) has the molecular formula C8H20OSSi2 and a molecular weight of 220.49 g/mol. Its IUPAC name is (2,2,3,3-tetramethyloxadisilinan-6-yl)methanethiol.
| Compound Name | (2,2,3,3-tetramethyloxadisilinan-6-yl)methanethiol |
|---|---|
| PubChem CID | 175382099 |
| Molecular Formula | C8H20OSSi2 |
| Molecular Weight | 220.49 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (2,2,3,3-tetramethyloxadisilinan-6-yl)methanethiol |
| SMILES | C[Si]1(C)CCC(CS)O[Si]1(C)C |
| InChI | InChI=1S/C8H20OSSi2/c1-11(2)6-5-8(7-10)9-12(11,3)4/h8,10H,5-7H2,1-4H3 |
| InChIKey | PAGVPRFGZNNIPN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|