C10H21NOSi2 — CID 70563507
2-(2,2,3,3,6-pentamethyloxadisilinan-6-yl)acetonitrile (PubChem CID 70563507) has the molecular formula C10H21NOSi2 and a molecular weight of 227.46 g/mol. Its IUPAC name is 2-(2,2,3,3,6-pentamethyloxadisilinan-6-yl)acetonitrile.
| Compound Name | 2-(2,2,3,3,6-pentamethyloxadisilinan-6-yl)acetonitrile |
|---|---|
| PubChem CID | 70563507 |
| Molecular Formula | C10H21NOSi2 |
| Molecular Weight | 227.46 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-(2,2,3,3,6-pentamethyloxadisilinan-6-yl)acetonitrile |
| SMILES | CC1(CC#N)CC[Si](C)(C)[Si](C)(C)O1 |
| InChI | InChI=1S/C10H21NOSi2/c1-10(6-8-11)7-9-13(2,3)14(4,5)12-10/h6-7,9H2,1-5H3 |
| InChIKey | RGDSATAKNHCURV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|