C15H32N2OSi2 — CID 67745467
1-(2,2,3,3-tetramethyl-6-pyrrolidin-1-yloxadisilinan-6-yl)pyrrolidine (PubChem CID 67745467) has the molecular formula C15H32N2OSi2 and a molecular weight of 312.61 g/mol. Its IUPAC name is 1-(2,2,3,3-tetramethyl-6-pyrrolidin-1-yloxadisilinan-6-yl)pyrrolidine.
| Compound Name | 1-(2,2,3,3-tetramethyl-6-pyrrolidin-1-yloxadisilinan-6-yl)pyrrolidine |
|---|---|
| PubChem CID | 67745467 |
| Molecular Formula | C15H32N2OSi2 |
| Molecular Weight | 312.61 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 1-(2,2,3,3-tetramethyl-6-pyrrolidin-1-yloxadisilinan-6-yl)pyrrolidine |
| SMILES | C[Si]1(C)CCC(N2CCCC2)(N2CCCC2)O[Si]1(C)C |
| InChI | InChI=1S/C15H32N2OSi2/c1-19(2)14-9-15(18-20(19,3)4,16-10-5-6-11-16)17-12-7-8-13-17/h5-14H2,1-4H3 |
| InChIKey | VYLUCYPACIVLSU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.61 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|