C10H22O2Si2 — CID 175506003
2,2,3,3-tetramethyl-6-(oxiran-2-ylmethyl)oxadisilinane (PubChem CID 175506003) has the molecular formula C10H22O2Si2 and a molecular weight of 230.46 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-6-(oxiran-2-ylmethyl)oxadisilinane.
| Compound Name | 2,2,3,3-tetramethyl-6-(oxiran-2-ylmethyl)oxadisilinane |
|---|---|
| PubChem CID | 175506003 |
| Molecular Formula | C10H22O2Si2 |
| Molecular Weight | 230.46 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 2,2,3,3-tetramethyl-6-(oxiran-2-ylmethyl)oxadisilinane |
| SMILES | C[Si]1(C)CCC(CC2CO2)O[Si]1(C)C |
| InChI | InChI=1S/C10H22O2Si2/c1-13(2)6-5-9(7-10-8-11-10)12-14(13,3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | DIGDTFDEAZTTMF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|