C7H17ClOSi2 — CID 175582172
3-chloro-2,2,3,6-tetramethyloxadisilinane (PubChem CID 175582172) has the molecular formula C7H17ClOSi2 and a molecular weight of 208.84 g/mol. Its IUPAC name is 3-chloro-2,2,3,6-tetramethyloxadisilinane.
| Compound Name | 3-chloro-2,2,3,6-tetramethyloxadisilinane |
|---|---|
| PubChem CID | 175582172 |
| Molecular Formula | C7H17ClOSi2 |
| Molecular Weight | 208.84 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 3-chloro-2,2,3,6-tetramethyloxadisilinane |
| SMILES | CC1CC[Si](C)(Cl)[Si](C)(C)O1 |
| InChI | InChI=1S/C7H17ClOSi2/c1-7-5-6-11(4,8)10(2,3)9-7/h7H,5-6H2,1-4H3 |
| InChIKey | WQYRGRGKNDADAR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.84 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|