C9H22O3Si2 — CID 174469372
(2,6-dimethyloxasilinan-2-yl)oxy-propan-2-yloxysilane (PubChem CID 174469372) has the molecular formula C9H22O3Si2 and a molecular weight of 234.44 g/mol. Its IUPAC name is (2,6-dimethyloxasilinan-2-yl)oxy-propan-2-yloxysilane.
| Compound Name | (2,6-dimethyloxasilinan-2-yl)oxy-propan-2-yloxysilane |
|---|---|
| PubChem CID | 174469372 |
| Molecular Formula | C9H22O3Si2 |
| Molecular Weight | 234.44 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | (2,6-dimethyloxasilinan-2-yl)oxy-propan-2-yloxysilane |
| SMILES | CC(C)O[SiH2]O[Si]1(C)CCCC(C)O1 |
| InChI | InChI=1S/C9H22O3Si2/c1-8(2)10-13-12-14(4)7-5-6-9(3)11-14/h8-9H,5-7,13H2,1-4H3 |
| InChIKey | IQDXGBLDTDZIGA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|