C27H29F3N4O4S — CID 175109812
1-[2-[2-hydroxy-N-sulfino-5-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]anilino]ethyl]-4-methylpiperazine (PubChem CID 175109812) has the molecular formula C27H29F3N4O4S and a molecular weight of 562.61 g/mol. Its IUPAC name is 1-[2-[2-hydroxy-N-sulfino-5-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]anilino]ethyl]-4-methylpiperazine.
| Compound Name | 1-[2-[2-hydroxy-N-sulfino-5-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]anilino]ethyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 175109812 |
| Molecular Formula | C27H29F3N4O4S |
| Molecular Weight | 562.61 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | 1-[2-[2-hydroxy-N-sulfino-5-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]anilino]ethyl]-4-methylpiperazine |
| SMILES | CN1CCN(CCN(c2cc(NC(=O)c3ccc(-c4ccc(C(F)(F)F)cc4)cc3)ccc2O)S(=O)O)CC1 |
| InChI | InChI=1S/C27H29F3N4O4S/c1-32-12-14-33(15-13-32)16-17-34(39(37)38)24-18-23(10-11-25(24)35)31-26(36)21-4-2-19(3-5-21)20-6-8-22(9-7-20)27(28,29)30/h2-11,18,35H,12-17H2,1H3,(H,31,36)(H,37,38) |
| InChIKey | VZLAIBBQQNVIIP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.61 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|