C23H22F3N3O6S2 — CID 175109820
1-hydroxy-2-[2-(methanesulfonamido)ethyl-sulfinoamino]-4-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzene (PubChem CID 175109820) has the molecular formula C23H22F3N3O6S2 and a molecular weight of 557.57 g/mol. Its IUPAC name is 1-hydroxy-2-[2-(methanesulfonamido)ethyl-sulfinoamino]-4-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzene.
| Compound Name | 1-hydroxy-2-[2-(methanesulfonamido)ethyl-sulfinoamino]-4-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzene |
|---|---|
| PubChem CID | 175109820 |
| Molecular Formula | C23H22F3N3O6S2 |
| Molecular Weight | 557.57 g/mol |
| Exact Mass | 557.09 |
| IUPAC Name | 1-hydroxy-2-[2-(methanesulfonamido)ethyl-sulfinoamino]-4-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzene |
| SMILES | CS(=O)(=O)NCCN(c1cc(NC(=O)c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)ccc1O)S(=O)O |
| InChI | InChI=1S/C23H22F3N3O6S2/c1-37(34,35)27-12-13-29(36(32)33)20-14-19(10-11-21(20)30)28-22(31)17-4-2-15(3-5-17)16-6-8-18(9-7-16)23(24,25)26/h2-11,14,27,30H,12-13H2,1H3,(H,28,31)(H,32,33) |
| InChIKey | NKDKBNPZFASMSV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|