C24H22F3N3O5S — CID 175113294
2-[(4-amino-4-oxobutyl)-sulfinoamino]-1-hydroxy-4-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzene (PubChem CID 175113294) has the molecular formula C24H22F3N3O5S and a molecular weight of 521.52 g/mol. Its IUPAC name is 2-[(4-amino-4-oxobutyl)-sulfinoamino]-1-hydroxy-4-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzene.
| Compound Name | 2-[(4-amino-4-oxobutyl)-sulfinoamino]-1-hydroxy-4-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzene |
|---|---|
| PubChem CID | 175113294 |
| Molecular Formula | C24H22F3N3O5S |
| Molecular Weight | 521.52 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | 2-[(4-amino-4-oxobutyl)-sulfinoamino]-1-hydroxy-4-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzene |
| SMILES | NC(=O)CCCN(c1cc(NC(=O)c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)ccc1O)S(=O)O |
| InChI | InChI=1S/C24H22F3N3O5S/c25-24(26,27)18-9-7-16(8-10-18)15-3-5-17(6-4-15)23(33)29-19-11-12-21(31)20(14-19)30(36(34)35)13-1-2-22(28)32/h3-12,14,31H,1-2,13H2,(H2,28,32)(H,29,33)(H,34,35) |
| InChIKey | GHFQSZQSNQNLEE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|