C25H19F2N3O6S2 — CID 175108084
1-fluoro-4-[4-[[3-(4-fluoro-N-sulfinoanilino)-4-hydroxyphenyl]carbamoyl]phenyl]-2-sulfamoylbenzene (PubChem CID 175108084) has the molecular formula C25H19F2N3O6S2 and a molecular weight of 559.57 g/mol. Its IUPAC name is 1-fluoro-4-[4-[[3-(4-fluoro-N-sulfinoanilino)-4-hydroxyphenyl]carbamoyl]phenyl]-2-sulfamoylbenzene.
| Compound Name | 1-fluoro-4-[4-[[3-(4-fluoro-N-sulfinoanilino)-4-hydroxyphenyl]carbamoyl]phenyl]-2-sulfamoylbenzene |
|---|---|
| PubChem CID | 175108084 |
| Molecular Formula | C25H19F2N3O6S2 |
| Molecular Weight | 559.57 g/mol |
| Exact Mass | 559.07 |
| IUPAC Name | 1-fluoro-4-[4-[[3-(4-fluoro-N-sulfinoanilino)-4-hydroxyphenyl]carbamoyl]phenyl]-2-sulfamoylbenzene |
| SMILES | NS(=O)(=O)c1cc(-c2ccc(C(=O)Nc3ccc(O)c(N(c4ccc(F)cc4)S(=O)O)c3)cc2)ccc1F |
| InChI | InChI=1S/C25H19F2N3O6S2/c26-18-6-9-20(10-7-18)30(37(33)34)22-14-19(8-12-23(22)31)29-25(32)16-3-1-15(2-4-16)17-5-11-21(27)24(13-17)38(28,35)36/h1-14,31H,(H,29,32)(H,33,34)(H2,28,35,36) |
| InChIKey | YTPRMKYPBJYHSF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|