C25H17ClFN2O4S- — CID 175114942
2-chloro-4-[[3-(4-fluoro-N-sulfinatoanilino)-4-hydroxyphenyl]carbamoyl]-1-phenylbenzene (PubChem CID 175114942) has the molecular formula C25H17ClFN2O4S- and a molecular weight of 495.94 g/mol. Its IUPAC name is 2-chloro-4-[[3-(4-fluoro-N-sulfinatoanilino)-4-hydroxyphenyl]carbamoyl]-1-phenylbenzene.
| Compound Name | 2-chloro-4-[[3-(4-fluoro-N-sulfinatoanilino)-4-hydroxyphenyl]carbamoyl]-1-phenylbenzene |
|---|---|
| PubChem CID | 175114942 |
| Molecular Formula | C25H17ClFN2O4S- |
| Molecular Weight | 495.94 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | 2-chloro-4-[[3-(4-fluoro-N-sulfinatoanilino)-4-hydroxyphenyl]carbamoyl]-1-phenylbenzene |
| SMILES | O=C(Nc1ccc(O)c(N(c2ccc(F)cc2)S(=O)[O-])c1)c1ccc(-c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C25H18ClFN2O4S/c26-22-14-17(6-12-21(22)16-4-2-1-3-5-16)25(31)28-19-9-13-24(30)23(15-19)29(34(32)33)20-10-7-18(27)8-11-20/h1-15,30H,(H,28,31)(H,32,33)/p-1 |
| InChIKey | IBUGSBJPGOUWIR-UHFFFAOYSA-M |
| XLogP | 6.04 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.94 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|