C26H18F4N2O4S — CID 175111184
1-[[3-(4-fluoro-N-sulfinoanilino)-4-hydroxyphenyl]carbamoyl]-4-phenyl-2-(trifluoromethyl)benzene (PubChem CID 175111184) has the molecular formula C26H18F4N2O4S and a molecular weight of 530.50 g/mol. Its IUPAC name is 1-[[3-(4-fluoro-N-sulfinoanilino)-4-hydroxyphenyl]carbamoyl]-4-phenyl-2-(trifluoromethyl)benzene.
| Compound Name | 1-[[3-(4-fluoro-N-sulfinoanilino)-4-hydroxyphenyl]carbamoyl]-4-phenyl-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 175111184 |
| Molecular Formula | C26H18F4N2O4S |
| Molecular Weight | 530.50 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | 1-[[3-(4-fluoro-N-sulfinoanilino)-4-hydroxyphenyl]carbamoyl]-4-phenyl-2-(trifluoromethyl)benzene |
| SMILES | O=C(Nc1ccc(O)c(N(c2ccc(F)cc2)S(=O)O)c1)c1ccc(-c2ccccc2)cc1C(F)(F)F |
| InChI | InChI=1S/C26H18F4N2O4S/c27-18-7-10-20(11-8-18)32(37(35)36)23-15-19(9-13-24(23)33)31-25(34)21-12-6-17(14-22(21)26(28,29)30)16-4-2-1-3-5-16/h1-15,33H,(H,31,34)(H,35,36) |
| InChIKey | QVLPMGJZPCAYKO-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.50 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|