C15H17BN3O9S2- — CID 91141158
1-boronooxy-4-[[4-hydroxy-3-[methyl(sulfinato)amino]phenyl]carbamoyl]-2-(methanesulfonamido)benzene (PubChem CID 91141158) has the molecular formula C15H17BN3O9S2- and a molecular weight of 458.26 g/mol. Its IUPAC name is 1-boronooxy-4-[[4-hydroxy-3-[methyl(sulfinato)amino]phenyl]carbamoyl]-2-(methanesulfonamido)benzene.
| Compound Name | 1-boronooxy-4-[[4-hydroxy-3-[methyl(sulfinato)amino]phenyl]carbamoyl]-2-(methanesulfonamido)benzene |
|---|---|
| PubChem CID | 91141158 |
| Molecular Formula | C15H17BN3O9S2- |
| Molecular Weight | 458.26 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 1-boronooxy-4-[[4-hydroxy-3-[methyl(sulfinato)amino]phenyl]carbamoyl]-2-(methanesulfonamido)benzene |
| SMILES | CN(c1cc(NC(=O)c2ccc(OB(O)O)c(NS(C)(=O)=O)c2)ccc1O)S(=O)[O-] |
| InChI | InChI=1S/C15H18BN3O9S2/c1-19(29(24)25)12-8-10(4-5-13(12)20)17-15(21)9-3-6-14(28-16(22)23)11(7-9)18-30(2,26)27/h3-8,18,20,22-23H,1-2H3,(H,17,21)(H,24,25)/p-1 |
| InChIKey | CUKZAPURZUQUSX-UHFFFAOYSA-M |
| XLogP | -0.41 |
| TPSA | 188.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.26 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|