C23H28N4O2 — CID 175110293
1-[(E)-3-(3-cyclopentyl-1-phenylpyrazol-4-yl)prop-2-enoyl]piperidine-2-carboxamide (PubChem CID 175110293) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 1-[(E)-3-(3-cyclopentyl-1-phenylpyrazol-4-yl)prop-2-enoyl]piperidine-2-carboxamide.
| Compound Name | 1-[(E)-3-(3-cyclopentyl-1-phenylpyrazol-4-yl)prop-2-enoyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 175110293 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 1-[(E)-3-(3-cyclopentyl-1-phenylpyrazol-4-yl)prop-2-enoyl]piperidine-2-carboxamide |
| SMILES | NC(=O)C1CCCCN1C(=O)/C=C/c1cn(-c2ccccc2)nc1C1CCCC1 |
| InChI | InChI=1S/C23H28N4O2/c24-23(29)20-12-6-7-15-26(20)21(28)14-13-18-16-27(19-10-2-1-3-11-19)25-22(18)17-8-4-5-9-17/h1-3,10-11,13-14,16-17,20H,4-9,12,15H2,(H2,24,29)/b14-13+ |
| InChIKey | AMWYXJCTTDZOIW-BUHFOSPRSA-N |
| XLogP | 3.41 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|