About sodium;hydride;propyl 3-amino-3-oxoprop-1-ene-1-sulfonate
sodium;hydride;propyl 3-amino-3-oxoprop-1-ene-1-sulfonate (PubChem CID 175110912) has the molecular formula C6H12NNaO4S
and a molecular weight of 217.22 g/mol. Its IUPAC name is sodium;hydride;propyl 3-amino-3-oxoprop-1-ene-1-sulfonate.
Molecular Properties
| Compound Name | sodium;hydride;propyl 3-amino-3-oxoprop-1-ene-1-sulfonate |
| PubChem CID | 175110912 |
| Molecular Formula | C6H12NNaO4S |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | sodium;hydride;propyl 3-amino-3-oxoprop-1-ene-1-sulfonate |
| SMILES | CCCOS(=O)(=O)C=CC(N)=O.[H-].[Na+] |
| InChI | InChI=1S/C6H11NO4S.Na.H/c1-2-4-11-12(9,10)5-3-6(7)8;;/h3,5H,2,4H2,1H3,(H2,7,8);;/q;+1;-1 |
| InChIKey | YLXUJWDOEUUFAW-UHFFFAOYSA-N |
| XLogP | -3.14 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;propyl 3-amino-3-oxoprop-1-ene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;propyl 3-amino-3-oxoprop-1-ene-1-sulfonate?
The IUPAC name of sodium;hydride;propyl 3-amino-3-oxoprop-1-ene-1-sulfonate (CID 175110912) is sodium;hydride;propyl 3-amino-3-oxoprop-1-ene-1-sulfonate.
What is the SMILES notation for sodium;hydride;propyl 3-amino-3-oxoprop-1-ene-1-sulfonate?
The canonical SMILES for sodium;hydride;propyl 3-amino-3-oxoprop-1-ene-1-sulfonate is CCCOS(=O)(=O)C=CC(N)=O.[H-].[Na+].
What is the InChIKey of sodium;hydride;propyl 3-amino-3-oxoprop-1-ene-1-sulfonate?
The InChIKey is YLXUJWDOEUUFAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO4S.Na.H/c1-2-4-11-12(9,10)5-3-6(7)8;;/h3,5H,2,4H2,1H3,(H2,7,8);;/q;+1;-1.
What are the key properties of sodium;hydride;propyl 3-amino-3-oxoprop-1-ene-1-sulfonate?
sodium;hydride;propyl 3-amino-3-oxoprop-1-ene-1-sulfonate has a molecular weight of 217.22 g/mol, XLogP of -3.14, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;propyl 3-amino-3-oxoprop-1-ene-1-sulfonate is sourced from PubChem (CID 175110912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).