C13H32N3O4P — CID 175114153
2-[3-(6-aminohexylamino)propyl-dimethylazaniumyl]ethyl hydrogen phosphate (PubChem CID 175114153) has the molecular formula C13H32N3O4P and a molecular weight of 325.39 g/mol. Its IUPAC name is 2-[3-(6-aminohexylamino)propyl-dimethylazaniumyl]ethyl hydrogen phosphate.
| Compound Name | 2-[3-(6-aminohexylamino)propyl-dimethylazaniumyl]ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 175114153 |
| Molecular Formula | C13H32N3O4P |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | 2-[3-(6-aminohexylamino)propyl-dimethylazaniumyl]ethyl hydrogen phosphate |
| SMILES | C[N+](C)(CCCNCCCCCCN)CCOP(=O)([O-])O |
| InChI | InChI=1S/C13H32N3O4P/c1-16(2,12-13-20-21(17,18)19)11-7-10-15-9-6-4-3-5-8-14/h15H,3-14H2,1-2H3,(H-,17,18,19) |
| InChIKey | TXNWDUNXROPZMN-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 107.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|