C17H17N5O6 — CID 175118166
6-(4-nitrophenyl)-5-phenylmethoxycarbonyltetrazinane-2-carboxylic acid (PubChem CID 175118166) has the molecular formula C17H17N5O6 and a molecular weight of 387.35 g/mol. Its IUPAC name is 6-(4-nitrophenyl)-5-phenylmethoxycarbonyltetrazinane-2-carboxylic acid.
| Compound Name | 6-(4-nitrophenyl)-5-phenylmethoxycarbonyltetrazinane-2-carboxylic acid |
|---|---|
| PubChem CID | 175118166 |
| Molecular Formula | C17H17N5O6 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 6-(4-nitrophenyl)-5-phenylmethoxycarbonyltetrazinane-2-carboxylic acid |
| SMILES | O=C(OCc1ccccc1)C1NNN(C(=O)O)NC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H17N5O6/c23-16(28-10-11-4-2-1-3-5-11)15-14(19-21(17(24)25)20-18-15)12-6-8-13(9-7-12)22(26)27/h1-9,14-15,18-20H,10H2,(H,24,25) |
| InChIKey | GLWJPKDOXLMMSU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 146.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|