C16H19N7 — CID 175118510
6-(4-butyl-2-phenylimidazol-1-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 175118510) has the molecular formula C16H19N7 and a molecular weight of 309.38 g/mol. Its IUPAC name is 6-(4-butyl-2-phenylimidazol-1-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(4-butyl-2-phenylimidazol-1-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 175118510 |
| Molecular Formula | C16H19N7 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 6-(4-butyl-2-phenylimidazol-1-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCc1cn(-c2nc(N)nc(N)n2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H19N7/c1-2-3-9-12-10-23(16-21-14(17)20-15(18)22-16)13(19-12)11-7-5-4-6-8-11/h4-8,10H,2-3,9H2,1H3,(H4,17,18,20,21,22) |
| InChIKey | FVYHHNVSPIPJKW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 108.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |