C21H18Cl5N3O3 — CID 175123616
2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-morpholin-2-ylbenzamide (PubChem CID 175123616) has the molecular formula C21H18Cl5N3O3 and a molecular weight of 537.66 g/mol. Its IUPAC name is 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-morpholin-2-ylbenzamide.
| Compound Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-morpholin-2-ylbenzamide |
|---|---|
| PubChem CID | 175123616 |
| Molecular Formula | C21H18Cl5N3O3 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 534.98 |
| IUPAC Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-morpholin-2-ylbenzamide |
| SMILES | O=C(NC1CNCCO1)c1cc(NC(=O)[C@H]2[C@H](c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C21H18Cl5N3O3/c22-11-5-10(6-12(23)7-11)17-18(21(17,25)26)20(31)28-13-1-2-15(24)14(8-13)19(30)29-16-9-27-3-4-32-16/h1-2,5-8,16-18,27H,3-4,9H2,(H,28,31)(H,29,30)/t16?,17-,18+/m0/s1 |
| InChIKey | GVVLTVSAOLVYQM-UQJFVLDMSA-N |
| XLogP | 4.85 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|