C30H55NO12 — CID 175125117
N-[[3,4,5-tris[2-[2-(ethoxymethoxy)ethoxy]ethoxy]phenyl]methyl]ethanamine (PubChem CID 175125117) has the molecular formula C30H55NO12 and a molecular weight of 621.77 g/mol. Its IUPAC name is N-[[3,4,5-tris[2-[2-(ethoxymethoxy)ethoxy]ethoxy]phenyl]methyl]ethanamine.
| Compound Name | N-[[3,4,5-tris[2-[2-(ethoxymethoxy)ethoxy]ethoxy]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 175125117 |
| Molecular Formula | C30H55NO12 |
| Molecular Weight | 621.77 g/mol |
| Exact Mass | 621.37 |
| IUPAC Name | N-[[3,4,5-tris[2-[2-(ethoxymethoxy)ethoxy]ethoxy]phenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(OCCOCCOCOCC)c(OCCOCCOCOCC)c(OCCOCCOCOCC)c1 |
| InChI | InChI=1S/C30H55NO12/c1-5-31-23-27-21-28(41-18-15-35-9-12-38-24-32-6-2)30(43-20-17-37-11-14-40-26-34-8-4)29(22-27)42-19-16-36-10-13-39-25-33-7-3/h21-22,31H,5-20,23-26H2,1-4H3 |
| InChIKey | APVFDKCCUMZELD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 122.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.77 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|