C29H37Cl2N3O2 — CID 175126836
(3S,5R,6S)-5-(3-chlorophenyl)-6-(5-chloro-2-pyridinyl)-3-methyl-1-(1-morpholin-4-ylbutan-2-yl)-3-prop-2-enylpiperidine-2-carbaldehyde (PubChem CID 175126836) has the molecular formula C29H37Cl2N3O2 and a molecular weight of 530.54 g/mol. Its IUPAC name is (3S,5R,6S)-5-(3-chlorophenyl)-6-(5-chloro-2-pyridinyl)-3-methyl-1-(1-morpholin-4-ylbutan-2-yl)-3-prop-2-enylpiperidine-2-carbaldehyde.
| Compound Name | (3S,5R,6S)-5-(3-chlorophenyl)-6-(5-chloro-2-pyridinyl)-3-methyl-1-(1-morpholin-4-ylbutan-2-yl)-3-prop-2-enylpiperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 175126836 |
| Molecular Formula | C29H37Cl2N3O2 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | (3S,5R,6S)-5-(3-chlorophenyl)-6-(5-chloro-2-pyridinyl)-3-methyl-1-(1-morpholin-4-ylbutan-2-yl)-3-prop-2-enylpiperidine-2-carbaldehyde |
| SMILES | C=CC[C@@]1(C)C[C@H](c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cn2)N(C(CC)CN2CCOCC2)C1C=O |
| InChI | InChI=1S/C29H37Cl2N3O2/c1-4-11-29(3)17-25(21-7-6-8-22(30)16-21)28(26-10-9-23(31)18-32-26)34(27(29)20-35)24(5-2)19-33-12-14-36-15-13-33/h4,6-10,16,18,20,24-25,27-28H,1,5,11-15,17,19H2,2-3H3/t24?,25-,27?,28+,29+/m1/s1 |
| InChIKey | JBOIPEXWKZQFJV-YMUDRKTQSA-N |
| XLogP | 6.18 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|