C26H32Cl2NO4S- — CID 174684742
1-[5-(3-chlorophenyl)-6-(4-chlorophenyl)-2-formyl-3-methyl-1-pentan-3-ylpiperidin-3-yl]ethyl sulfite (PubChem CID 174684742) has the molecular formula C26H32Cl2NO4S- and a molecular weight of 525.52 g/mol. Its IUPAC name is 1-[5-(3-chlorophenyl)-6-(4-chlorophenyl)-2-formyl-3-methyl-1-pentan-3-ylpiperidin-3-yl]ethyl sulfite.
| Compound Name | 1-[5-(3-chlorophenyl)-6-(4-chlorophenyl)-2-formyl-3-methyl-1-pentan-3-ylpiperidin-3-yl]ethyl sulfite |
|---|---|
| PubChem CID | 174684742 |
| Molecular Formula | C26H32Cl2NO4S- |
| Molecular Weight | 525.52 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | 1-[5-(3-chlorophenyl)-6-(4-chlorophenyl)-2-formyl-3-methyl-1-pentan-3-ylpiperidin-3-yl]ethyl sulfite |
| SMILES | CCC(CC)N1C(c2ccc(Cl)cc2)C(c2cccc(Cl)c2)CC(C)(C(C)OS(=O)[O-])C1C=O |
| InChI | InChI=1S/C26H33Cl2NO4S/c1-5-22(6-2)29-24(16-30)26(4,17(3)33-34(31)32)15-23(19-8-7-9-21(28)14-19)25(29)18-10-12-20(27)13-11-18/h7-14,16-17,22-25H,5-6,15H2,1-4H3,(H,31,32)/p-1 |
| InChIKey | ZANBDKXZSPJFRF-UHFFFAOYSA-M |
| XLogP | 6.49 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.52 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|