C9H5Cl2IO3 — CID 175128350
3-(3,5-dichlorophenyl)-2-iodo-3-oxopropanoic acid (PubChem CID 175128350) has the molecular formula C9H5Cl2IO3 and a molecular weight of 358.95 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-2-iodo-3-oxopropanoic acid.
| Compound Name | 3-(3,5-dichlorophenyl)-2-iodo-3-oxopropanoic acid |
|---|---|
| PubChem CID | 175128350 |
| Molecular Formula | C9H5Cl2IO3 |
| Molecular Weight | 358.95 g/mol |
| Exact Mass | 357.87 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-2-iodo-3-oxopropanoic acid |
| SMILES | O=C(O)C(I)C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C9H5Cl2IO3/c10-5-1-4(2-6(11)3-5)8(13)7(12)9(14)15/h1-3,7H,(H,14,15) |
| InChIKey | WAFVGTITUXYUFO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.95 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|