C29H56Cl4 — CID 175132545
12-tert-butyl-2,6,8,11-tetrachloro-3,7-diethyl-5,9-di(propan-2-yl)pentadecane (PubChem CID 175132545) has the molecular formula C29H56Cl4 and a molecular weight of 546.58 g/mol. Its IUPAC name is 12-tert-butyl-2,6,8,11-tetrachloro-3,7-diethyl-5,9-di(propan-2-yl)pentadecane.
| Compound Name | 12-tert-butyl-2,6,8,11-tetrachloro-3,7-diethyl-5,9-di(propan-2-yl)pentadecane |
|---|---|
| PubChem CID | 175132545 |
| Molecular Formula | C29H56Cl4 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | 12-tert-butyl-2,6,8,11-tetrachloro-3,7-diethyl-5,9-di(propan-2-yl)pentadecane |
| SMILES | CCCC(C(Cl)CC(C(C)C)C(Cl)C(CC)C(Cl)C(CC(CC)C(C)Cl)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C29H56Cl4/c1-12-15-25(29(9,10)11)26(31)17-24(19(6)7)28(33)22(14-3)27(32)23(18(4)5)16-21(13-2)20(8)30/h18-28H,12-17H2,1-11H3 |
| InChIKey | OZBHTFVCKCPBNF-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|