C21H28FN3O2S — CID 175138494
[4-[2-[4-(1-benzothiophen-4-yl)piperazin-1-yl]ethyl]-4-fluorocyclohexyl] carbamate (PubChem CID 175138494) has the molecular formula C21H28FN3O2S and a molecular weight of 405.54 g/mol. Its IUPAC name is [4-[2-[4-(1-benzothiophen-4-yl)piperazin-1-yl]ethyl]-4-fluorocyclohexyl] carbamate.
| Compound Name | [4-[2-[4-(1-benzothiophen-4-yl)piperazin-1-yl]ethyl]-4-fluorocyclohexyl] carbamate |
|---|---|
| PubChem CID | 175138494 |
| Molecular Formula | C21H28FN3O2S |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | [4-[2-[4-(1-benzothiophen-4-yl)piperazin-1-yl]ethyl]-4-fluorocyclohexyl] carbamate |
| SMILES | NC(=O)OC1CCC(F)(CCN2CCN(c3cccc4sccc34)CC2)CC1 |
| InChI | InChI=1S/C21H28FN3O2S/c22-21(7-4-16(5-8-21)27-20(23)26)9-10-24-11-13-25(14-12-24)18-2-1-3-19-17(18)6-15-28-19/h1-3,6,15-16H,4-5,7-14H2,(H2,23,26) |
| InChIKey | QBYUEDPWOUCSJS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |