C29H33N5O4S — CID 175138816
5,7,11-triamino-6-oxo-7-(4-propan-2-yloxyphenyl)-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 175138816) has the molecular formula C29H33N5O4S and a molecular weight of 547.68 g/mol. Its IUPAC name is 5,7,11-triamino-6-oxo-7-(4-propan-2-yloxyphenyl)-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 5,7,11-triamino-6-oxo-7-(4-propan-2-yloxyphenyl)-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 175138816 |
| Molecular Formula | C29H33N5O4S |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | 5,7,11-triamino-6-oxo-7-(4-propan-2-yloxyphenyl)-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)N[C@H]1CCC[C@H]1NC(=O)c1sc2c(N)ccc3c2c1C(N)C(=O)C3(N)c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C29H33N5O4S/c1-4-21(35)33-19-6-5-7-20(19)34-28(37)26-23-22-17(12-13-18(30)25(22)39-26)29(32,27(36)24(23)31)15-8-10-16(11-9-15)38-14(2)3/h4,8-14,19-20,24H,1,5-7,30-32H2,2-3H3,(H,33,35)(H,34,37)/t19-,20+,24?,29?/m0/s1 |
| InChIKey | LXYBNJOBCBORBH-WABKYECFSA-N |
| XLogP | 3.01 |
| TPSA | 162.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|