C32H38N6O4S — CID 175138761
5,7,11-triamino-7-(6-cyclopentyloxy-4-methyl-3-pyridinyl)-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclohexyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 175138761) has the molecular formula C32H38N6O4S and a molecular weight of 602.76 g/mol. Its IUPAC name is 5,7,11-triamino-7-(6-cyclopentyloxy-4-methyl-3-pyridinyl)-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclohexyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 5,7,11-triamino-7-(6-cyclopentyloxy-4-methyl-3-pyridinyl)-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclohexyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 175138761 |
| Molecular Formula | C32H38N6O4S |
| Molecular Weight | 602.76 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | 5,7,11-triamino-7-(6-cyclopentyloxy-4-methyl-3-pyridinyl)-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclohexyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)N[C@H]1CCCC[C@H]1NC(=O)c1sc2c(N)ccc3c2c1C(N)C(=O)C3(N)c1cnc(OC2CCCC2)cc1C |
| InChI | InChI=1S/C32H38N6O4S/c1-3-23(39)37-21-10-6-7-11-22(21)38-31(41)29-26-25-18(12-13-20(33)28(25)43-29)32(35,30(40)27(26)34)19-15-36-24(14-16(19)2)42-17-8-4-5-9-17/h3,12-15,17,21-22,27H,1,4-11,33-35H2,2H3,(H,37,39)(H,38,41)/t21-,22+,27?,32?/m0/s1 |
| InChIKey | AJNLMFGGURRTEZ-HELJUJJNSA-N |
| XLogP | 3.64 |
| TPSA | 175.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.76 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|