C29H32N6O3S — CID 175357380
5,7,11-triamino-7-(2-cyclobutyl-4-pyridinyl)-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 175357380) has the molecular formula C29H32N6O3S and a molecular weight of 544.68 g/mol. Its IUPAC name is 5,7,11-triamino-7-(2-cyclobutyl-4-pyridinyl)-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 5,7,11-triamino-7-(2-cyclobutyl-4-pyridinyl)-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 175357380 |
| Molecular Formula | C29H32N6O3S |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | 5,7,11-triamino-7-(2-cyclobutyl-4-pyridinyl)-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)N[C@H]1CCC[C@H]1NC(=O)c1sc2c(N)ccc3c2c1C(N)C(=O)C3(N)c1ccnc(C2CCC2)c1 |
| InChI | InChI=1S/C29H32N6O3S/c1-2-21(36)34-18-7-4-8-19(18)35-28(38)26-23-22-16(9-10-17(30)25(22)39-26)29(32,27(37)24(23)31)15-11-12-33-20(13-15)14-5-3-6-14/h2,9-14,18-19,24H,1,3-8,30-32H2,(H,34,36)(H,35,38)/t18-,19+,24?,29?/m0/s1 |
| InChIKey | IOBUBVFSFBOWCR-YVJRHLKESA-N |
| XLogP | 2.88 |
| TPSA | 166.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|