C8H16NO7P — CID 175138863
2-[[methoxy(propan-2-yloxycarbonyloxy)phosphoryl]amino]propanoic acid (PubChem CID 175138863) has the molecular formula C8H16NO7P and a molecular weight of 269.19 g/mol. Its IUPAC name is 2-[[methoxy(propan-2-yloxycarbonyloxy)phosphoryl]amino]propanoic acid.
| Compound Name | 2-[[methoxy(propan-2-yloxycarbonyloxy)phosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 175138863 |
| Molecular Formula | C8H16NO7P |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-[[methoxy(propan-2-yloxycarbonyloxy)phosphoryl]amino]propanoic acid |
| SMILES | COP(=O)(NC(C)C(=O)O)OC(=O)OC(C)C |
| InChI | InChI=1S/C8H16NO7P/c1-5(2)15-8(12)16-17(13,14-4)9-6(3)7(10)11/h5-6H,1-4H3,(H,9,13)(H,10,11) |
| InChIKey | IWBZBVAAYJHYCH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|