C24H32O — CID 175140451
3,6-bis(4-propan-2-ylphenyl)hexanal (PubChem CID 175140451) has the molecular formula C24H32O and a molecular weight of 336.52 g/mol. Its IUPAC name is 3,6-bis(4-propan-2-ylphenyl)hexanal.
| Compound Name | 3,6-bis(4-propan-2-ylphenyl)hexanal |
|---|---|
| PubChem CID | 175140451 |
| Molecular Formula | C24H32O |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 3,6-bis(4-propan-2-ylphenyl)hexanal |
| SMILES | CC(C)c1ccc(CCCC(CC=O)c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H32O/c1-18(2)21-10-8-20(9-11-21)6-5-7-23(16-17-25)24-14-12-22(13-15-24)19(3)4/h8-15,17-19,23H,5-7,16H2,1-4H3 |
| InChIKey | MDRXKNLQIDRHRJ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|