About dilithium;2-[2-(carboxylatoformyl)oxy-2-oxoacetyl]oxy-2-oxoacetate
dilithium;2-[2-(carboxylatoformyl)oxy-2-oxoacetyl]oxy-2-oxoacetate (PubChem CID 175143066) has the molecular formula C6Li2O10
and a molecular weight of 245.94 g/mol. Its IUPAC name is dilithium;2-[2-(carboxylatoformyl)oxy-2-oxoacetyl]oxy-2-oxoacetate.
Molecular Properties
| Compound Name | dilithium;2-[2-(carboxylatoformyl)oxy-2-oxoacetyl]oxy-2-oxoacetate |
| PubChem CID | 175143066 |
| Molecular Formula | C6Li2O10 |
| Molecular Weight | 245.94 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | dilithium;2-[2-(carboxylatoformyl)oxy-2-oxoacetyl]oxy-2-oxoacetate |
| SMILES | O=C([O-])C(=O)OC(=O)C(=O)OC(=O)C(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C6H2O10.2Li/c7-1(8)3(11)15-5(13)6(14)16-4(12)2(9)10;;/h(H,7,8)(H,9,10);;/q;2*+1/p-2 |
| InChIKey | MEPDMWJHOSNXFI-UHFFFAOYSA-L |
| XLogP | -11.37 |
| TPSA | 167.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.94 |
| LogP ≤ 5 | -11.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze dilithium;2-[2-(carboxylatoformyl)oxy-2-oxoacetyl]oxy-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;2-[2-(carboxylatoformyl)oxy-2-oxoacetyl]oxy-2-oxoacetate?
The IUPAC name of dilithium;2-[2-(carboxylatoformyl)oxy-2-oxoacetyl]oxy-2-oxoacetate (CID 175143066) is dilithium;2-[2-(carboxylatoformyl)oxy-2-oxoacetyl]oxy-2-oxoacetate.
What is the SMILES notation for dilithium;2-[2-(carboxylatoformyl)oxy-2-oxoacetyl]oxy-2-oxoacetate?
The canonical SMILES for dilithium;2-[2-(carboxylatoformyl)oxy-2-oxoacetyl]oxy-2-oxoacetate is O=C([O-])C(=O)OC(=O)C(=O)OC(=O)C(=O)[O-].[Li+].[Li+].
What is the InChIKey of dilithium;2-[2-(carboxylatoformyl)oxy-2-oxoacetyl]oxy-2-oxoacetate?
The InChIKey is MEPDMWJHOSNXFI-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H2O10.2Li/c7-1(8)3(11)15-5(13)6(14)16-4(12)2(9)10;;/h(H,7,8)(H,9,10);;/q;2*+1/p-2.
What are the key properties of dilithium;2-[2-(carboxylatoformyl)oxy-2-oxoacetyl]oxy-2-oxoacetate?
dilithium;2-[2-(carboxylatoformyl)oxy-2-oxoacetyl]oxy-2-oxoacetate has a molecular weight of 245.94 g/mol, XLogP of -11.37, 0 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;2-[2-(carboxylatoformyl)oxy-2-oxoacetyl]oxy-2-oxoacetate is sourced from PubChem (CID 175143066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).