About cesium;potassium;carboxylatooxycarbonyl carbonate
cesium;potassium;carboxylatooxycarbonyl carbonate (PubChem CID 174165319) has the molecular formula C3CsKO7
and a molecular weight of 320.03 g/mol. Its IUPAC name is cesium;potassium;carboxylatooxycarbonyl carbonate.
Molecular Properties
| Compound Name | cesium;potassium;carboxylatooxycarbonyl carbonate |
| PubChem CID | 174165319 |
| Molecular Formula | C3CsKO7 |
| Molecular Weight | 320.03 g/mol |
| Exact Mass | 319.83 |
| IUPAC Name | cesium;potassium;carboxylatooxycarbonyl carbonate |
| SMILES | O=C([O-])OC(=O)OC(=O)[O-].[Cs+].[K+] |
| InChI | InChI=1S/C3H2O7.Cs.K/c4-1(5)9-3(8)10-2(6)7;;/h(H,4,5)(H,6,7);;/q;2*+1/p-2 |
| InChIKey | DSKWOYTUKOPBDM-UHFFFAOYSA-L |
| XLogP | -8.17 |
| TPSA | 115.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.03 |
| LogP ≤ 5 | -8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze cesium;potassium;carboxylatooxycarbonyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium;potassium;carboxylatooxycarbonyl carbonate?
The IUPAC name of cesium;potassium;carboxylatooxycarbonyl carbonate (CID 174165319) is cesium;potassium;carboxylatooxycarbonyl carbonate.
What is the SMILES notation for cesium;potassium;carboxylatooxycarbonyl carbonate?
The canonical SMILES for cesium;potassium;carboxylatooxycarbonyl carbonate is O=C([O-])OC(=O)OC(=O)[O-].[Cs+].[K+].
What is the InChIKey of cesium;potassium;carboxylatooxycarbonyl carbonate?
The InChIKey is DSKWOYTUKOPBDM-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H2O7.Cs.K/c4-1(5)9-3(8)10-2(6)7;;/h(H,4,5)(H,6,7);;/q;2*+1/p-2.
What are the key properties of cesium;potassium;carboxylatooxycarbonyl carbonate?
cesium;potassium;carboxylatooxycarbonyl carbonate has a molecular weight of 320.03 g/mol, XLogP of -8.17, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for cesium;potassium;carboxylatooxycarbonyl carbonate is sourced from PubChem (CID 174165319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).