About magnesium carboxylato carbonate
magnesium carboxylato carbonate (PubChem CID 87890039) has the molecular formula C2MgO5
and a molecular weight of 128.32 g/mol. Its IUPAC name is magnesium carboxylato carbonate.
Molecular Properties
| Compound Name | magnesium carboxylato carbonate |
| PubChem CID | 87890039 |
| Molecular Formula | C2MgO5 |
| Molecular Weight | 128.32 g/mol |
| Exact Mass | 127.96 |
| IUPAC Name | magnesium carboxylato carbonate |
| SMILES | O=C([O-])OC(=O)[O-].[Mg+2] |
| InChI | InChI=1S/C2H2O5.Mg/c3-1(4)7-2(5)6;/h(H,3,4)(H,5,6);/q;+2/p-2 |
| InChIKey | BFDDHZDAVFUWCA-UHFFFAOYSA-L |
| XLogP | -2.69 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.32 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze magnesium carboxylato carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium carboxylato carbonate?
The IUPAC name of magnesium carboxylato carbonate (CID 87890039) is magnesium carboxylato carbonate.
What is the SMILES notation for magnesium carboxylato carbonate?
The canonical SMILES for magnesium carboxylato carbonate is O=C([O-])OC(=O)[O-].[Mg+2].
What is the InChIKey of magnesium carboxylato carbonate?
The InChIKey is BFDDHZDAVFUWCA-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H2O5.Mg/c3-1(4)7-2(5)6;/h(H,3,4)(H,5,6);/q;+2/p-2.
What are the key properties of magnesium carboxylato carbonate?
magnesium carboxylato carbonate has a molecular weight of 128.32 g/mol, XLogP of -2.69, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium carboxylato carbonate is sourced from PubChem (CID 87890039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).