About carboxylato carbonate;iron(3+)
carboxylato carbonate;iron(3+) (PubChem CID 172818813) has the molecular formula C2FeO5+
and a molecular weight of 159.86 g/mol. Its IUPAC name is carboxylato carbonate;iron(3+).
Molecular Properties
| Compound Name | carboxylato carbonate;iron(3+) |
| PubChem CID | 172818813 |
| Molecular Formula | C2FeO5+ |
| Molecular Weight | 159.86 g/mol |
| Exact Mass | 159.91 |
| IUPAC Name | carboxylato carbonate;iron(3+) |
| SMILES | O=C([O-])OC(=O)[O-].[Fe+3] |
| InChI | InChI=1S/C2H2O5.Fe/c3-1(4)7-2(5)6;/h(H,3,4)(H,5,6);/q;+3/p-2 |
| InChIKey | TYDSDILLHHVPLZ-UHFFFAOYSA-L |
| XLogP | -2.31 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.86 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze carboxylato carbonate;iron(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carboxylato carbonate;iron(3+)?
The IUPAC name of carboxylato carbonate;iron(3+) (CID 172818813) is carboxylato carbonate;iron(3+).
What is the SMILES notation for carboxylato carbonate;iron(3+)?
The canonical SMILES for carboxylato carbonate;iron(3+) is O=C([O-])OC(=O)[O-].[Fe+3].
What is the InChIKey of carboxylato carbonate;iron(3+)?
The InChIKey is TYDSDILLHHVPLZ-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H2O5.Fe/c3-1(4)7-2(5)6;/h(H,3,4)(H,5,6);/q;+3/p-2.
What are the key properties of carboxylato carbonate;iron(3+)?
carboxylato carbonate;iron(3+) has a molecular weight of 159.86 g/mol, XLogP of -2.31, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carboxylato carbonate;iron(3+) is sourced from PubChem (CID 172818813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).