About calcium bromo carbonate
calcium bromo carbonate (PubChem CID 142761680) has the molecular formula C2Br2CaO6
and a molecular weight of 319.90 g/mol. Its IUPAC name is calcium bromo carbonate.
Molecular Properties
| Compound Name | calcium bromo carbonate |
| PubChem CID | 142761680 |
| Molecular Formula | C2Br2CaO6 |
| Molecular Weight | 319.90 g/mol |
| Exact Mass | 317.77 |
| IUPAC Name | calcium bromo carbonate |
| SMILES | O=C([O-])OBr.O=C([O-])OBr.[Ca+2] |
| InChI | InChI=1S/2CHBrO3.Ca/c2*2-5-1(3)4;/h2*(H,3,4);/q;;+2/p-2 |
| InChIKey | MAJCKLJFMQJJHF-UHFFFAOYSA-L |
| XLogP | -1.07 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.90 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze calcium bromo carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium bromo carbonate?
The IUPAC name of calcium bromo carbonate (CID 142761680) is calcium bromo carbonate.
What is the SMILES notation for calcium bromo carbonate?
The canonical SMILES for calcium bromo carbonate is O=C([O-])OBr.O=C([O-])OBr.[Ca+2].
What is the InChIKey of calcium bromo carbonate?
The InChIKey is MAJCKLJFMQJJHF-UHFFFAOYSA-L. The full InChI is InChI=1S/2CHBrO3.Ca/c2*2-5-1(3)4;/h2*(H,3,4);/q;;+2/p-2.
What are the key properties of calcium bromo carbonate?
calcium bromo carbonate has a molecular weight of 319.90 g/mol, XLogP of -1.07, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for calcium bromo carbonate is sourced from PubChem (CID 142761680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).