About calcium;amino carbonate;hydroxide
calcium;amino carbonate;hydroxide (PubChem CID 155045529) has the molecular formula CH3CaNO4
and a molecular weight of 133.12 g/mol. Its IUPAC name is calcium;amino carbonate;hydroxide.
Molecular Properties
| Compound Name | calcium;amino carbonate;hydroxide |
| PubChem CID | 155045529 |
| Molecular Formula | CH3CaNO4 |
| Molecular Weight | 133.12 g/mol |
| Exact Mass | 132.97 |
| IUPAC Name | calcium;amino carbonate;hydroxide |
| SMILES | NOC(=O)[O-].[Ca+2].[OH-] |
| InChI | InChI=1S/CH3NO3.Ca.H2O/c2-5-1(3)4;;/h2H2,(H,3,4);;1H2/q;+2;/p-2 |
| InChIKey | GMNRBGMPWHMVSW-UHFFFAOYSA-L |
| XLogP | -2.34 |
| TPSA | 105.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.12 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze calcium;amino carbonate;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;amino carbonate;hydroxide?
The IUPAC name of calcium;amino carbonate;hydroxide (CID 155045529) is calcium;amino carbonate;hydroxide.
What is the SMILES notation for calcium;amino carbonate;hydroxide?
The canonical SMILES for calcium;amino carbonate;hydroxide is NOC(=O)[O-].[Ca+2].[OH-].
What is the InChIKey of calcium;amino carbonate;hydroxide?
The InChIKey is GMNRBGMPWHMVSW-UHFFFAOYSA-L. The full InChI is InChI=1S/CH3NO3.Ca.H2O/c2-5-1(3)4;;/h2H2,(H,3,4);;1H2/q;+2;/p-2.
What are the key properties of calcium;amino carbonate;hydroxide?
calcium;amino carbonate;hydroxide has a molecular weight of 133.12 g/mol, XLogP of -2.34, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;amino carbonate;hydroxide is sourced from PubChem (CID 155045529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).