C29H31N7O5S — CID 175143188
[(1R,2S)-2-[[5,7,11-triamino-7-(4-methyl-2-phenoxypyrimidin-5-yl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carbonyl]amino]cyclopentyl] carbamate (PubChem CID 175143188) has the molecular formula C29H31N7O5S and a molecular weight of 589.68 g/mol. Its IUPAC name is [(1R,2S)-2-[[5,7,11-triamino-7-(4-methyl-2-phenoxypyrimidin-5-yl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carbonyl]amino]cyclopentyl] carbamate.
| Compound Name | [(1R,2S)-2-[[5,7,11-triamino-7-(4-methyl-2-phenoxypyrimidin-5-yl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carbonyl]amino]cyclopentyl] carbamate |
|---|---|
| PubChem CID | 175143188 |
| Molecular Formula | C29H31N7O5S |
| Molecular Weight | 589.68 g/mol |
| Exact Mass | 589.21 |
| IUPAC Name | [(1R,2S)-2-[[5,7,11-triamino-7-(4-methyl-2-phenoxypyrimidin-5-yl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carbonyl]amino]cyclopentyl] carbamate |
| SMILES | Cc1nc(Oc2ccccc2)ncc1C1(N)C(=O)C(N)C2c3c1ccc(N)c3SC2C(=O)N[C@H]1CCC[C@H]1OC(N)=O |
| InChI | InChI=1S/C29H31N7O5S/c1-13-16(12-34-28(35-13)40-14-6-3-2-4-7-14)29(33)15-10-11-17(30)23-20(15)21(22(31)25(29)37)24(42-23)26(38)36-18-8-5-9-19(18)41-27(32)39/h2-4,6-7,10-12,18-19,21-22,24H,5,8-9,30-31,33H2,1H3,(H2,32,39)(H,36,38)/t18-,19+,21?,22?,24?,29?/m0/s1 |
| InChIKey | KPFMCIOQSAKWHY-GQRVQTQFSA-N |
| XLogP | 1.96 |
| TPSA | 211.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.68 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|