C13H14BrNO4 — CID 175144786
2-bromo-4-hydroxy-7-pentylfuro[2,3-c]pyridine-5-carboxylic acid (PubChem CID 175144786) has the molecular formula C13H14BrNO4 and a molecular weight of 328.16 g/mol. Its IUPAC name is 2-bromo-4-hydroxy-7-pentylfuro[2,3-c]pyridine-5-carboxylic acid.
| Compound Name | 2-bromo-4-hydroxy-7-pentylfuro[2,3-c]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 175144786 |
| Molecular Formula | C13H14BrNO4 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 2-bromo-4-hydroxy-7-pentylfuro[2,3-c]pyridine-5-carboxylic acid |
| SMILES | CCCCCc1nc(C(=O)O)c(O)c2cc(Br)oc12 |
| InChI | InChI=1S/C13H14BrNO4/c1-2-3-4-5-8-12-7(6-9(14)19-12)11(16)10(15-8)13(17)18/h6,16H,2-5H2,1H3,(H,17,18) |
| InChIKey | XAWIQUPIUFCOMA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|