C21H27N5O5 — CID 175145443
ethyl 5-[[4-(4-acetylpiperazin-1-yl)-2-amino-4-oxobutanoyl]amino]-1H-indole-2-carboxylate (PubChem CID 175145443) has the molecular formula C21H27N5O5 and a molecular weight of 429.48 g/mol. Its IUPAC name is ethyl 5-[[4-(4-acetylpiperazin-1-yl)-2-amino-4-oxobutanoyl]amino]-1H-indole-2-carboxylate.
| Compound Name | ethyl 5-[[4-(4-acetylpiperazin-1-yl)-2-amino-4-oxobutanoyl]amino]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 175145443 |
| Molecular Formula | C21H27N5O5 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | ethyl 5-[[4-(4-acetylpiperazin-1-yl)-2-amino-4-oxobutanoyl]amino]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(NC(=O)C(N)CC(=O)N3CCN(C(C)=O)CC3)ccc2[nH]1 |
| InChI | InChI=1S/C21H27N5O5/c1-3-31-21(30)18-11-14-10-15(4-5-17(14)24-18)23-20(29)16(22)12-19(28)26-8-6-25(7-9-26)13(2)27/h4-5,10-11,16,24H,3,6-9,12,22H2,1-2H3,(H,23,29) |
| InChIKey | GTHQRXMSGSJSBF-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 137.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |