C19H20BN3O4 — CID 175150496
[4-[4-(3-aminopropylcarbamoyl)quinolin-2-yl]phenoxy]boronic acid (PubChem CID 175150496) has the molecular formula C19H20BN3O4 and a molecular weight of 365.20 g/mol. Its IUPAC name is [4-[4-(3-aminopropylcarbamoyl)quinolin-2-yl]phenoxy]boronic acid.
| Compound Name | [4-[4-(3-aminopropylcarbamoyl)quinolin-2-yl]phenoxy]boronic acid |
|---|---|
| PubChem CID | 175150496 |
| Molecular Formula | C19H20BN3O4 |
| Molecular Weight | 365.20 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | [4-[4-(3-aminopropylcarbamoyl)quinolin-2-yl]phenoxy]boronic acid |
| SMILES | NCCCNC(=O)c1cc(-c2ccc(OB(O)O)cc2)nc2ccccc12 |
| InChI | InChI=1S/C19H20BN3O4/c21-10-3-11-22-19(24)16-12-18(23-17-5-2-1-4-15(16)17)13-6-8-14(9-7-13)27-20(25)26/h1-2,4-9,12,25-26H,3,10-11,21H2,(H,22,24) |
| InChIKey | OFEISPYCKLWNQB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.20 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|